C20H25NO4 — CID 168528418
tert-butyl 3-[4-(furan-2-yl)phenoxy]piperidine-1-carboxylate (PubChem CID 168528418) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is tert-butyl 3-[4-(furan-2-yl)phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(furan-2-yl)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168528418 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | tert-butyl 3-[4-(furan-2-yl)phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Oc2ccc(-c3ccco3)cc2)C1 |
| InChI | InChI=1S/C20H25NO4/c1-20(2,3)25-19(22)21-12-4-6-17(14-21)24-16-10-8-15(9-11-16)18-7-5-13-23-18/h5,7-11,13,17H,4,6,12,14H2,1-3H3 |
| InChIKey | DBGMBYUMFPTKNS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |