C24H29NO3 — CID 99902919
tert-butyl (3R)-3-[4-[(Z)-2-phenylethenyl]phenoxy]piperidine-1-carboxylate (PubChem CID 99902919) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl (3R)-3-[4-[(Z)-2-phenylethenyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[4-[(Z)-2-phenylethenyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 99902919 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | tert-butyl (3R)-3-[4-[(Z)-2-phenylethenyl]phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](Oc2ccc(/C=C\c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C24H29NO3/c1-24(2,3)28-23(26)25-17-7-10-22(18-25)27-21-15-13-20(14-16-21)12-11-19-8-5-4-6-9-19/h4-6,8-9,11-16,22H,7,10,17-18H2,1-3H3/b12-11-/t22-/m1/s1 |
| InChIKey | VQCNGDSLHBXRBA-SSSWZJSRSA-N |
| XLogP | 5.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|