C18H28N2O3 — CID 24902463
tert-butyl 3-[3-(dimethylamino)phenoxy]piperidine-1-carboxylate (PubChem CID 24902463) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl 3-[3-(dimethylamino)phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(dimethylamino)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24902463 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | tert-butyl 3-[3-(dimethylamino)phenoxy]piperidine-1-carboxylate |
| SMILES | CN(C)c1cccc(OC2CCCN(C(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C18H28N2O3/c1-18(2,3)23-17(21)20-11-7-10-16(13-20)22-15-9-6-8-14(12-15)19(4)5/h6,8-9,12,16H,7,10-11,13H2,1-5H3 |
| InChIKey | KJZPWKZFVBFSOY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |