C16H23FN2O3 — CID 57433448
tert-butyl 3-(3-amino-5-fluorophenoxy)piperidine-1-carboxylate (PubChem CID 57433448) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is tert-butyl 3-(3-amino-5-fluorophenoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-amino-5-fluorophenoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 57433448 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | tert-butyl 3-(3-amino-5-fluorophenoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Oc2cc(N)cc(F)c2)C1 |
| InChI | InChI=1S/C16H23FN2O3/c1-16(2,3)22-15(20)19-6-4-5-13(10-19)21-14-8-11(17)7-12(18)9-14/h7-9,13H,4-6,10,18H2,1-3H3 |
| InChIKey | DLUYYHAUUHBESS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|