C15H21ClN2O3 — CID 164584435
tert-butyl 3-(3-amino-5-chlorophenoxy)pyrrolidine-1-carboxylate (PubChem CID 164584435) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is tert-butyl 3-(3-amino-5-chlorophenoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-amino-5-chlorophenoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 164584435 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | tert-butyl 3-(3-amino-5-chlorophenoxy)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2cc(N)cc(Cl)c2)C1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-15(2,3)21-14(19)18-5-4-12(9-18)20-13-7-10(16)6-11(17)8-13/h6-8,12H,4-5,9,17H2,1-3H3 |
| InChIKey | UYXCCNLAGRWYSE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|