C15H22N2O4 — CID 140872433
tert-butyl (3S)-3-[(5-methoxy-3-pyridinyl)oxy]pyrrolidine-1-carboxylate (PubChem CID 140872433) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(5-methoxy-3-pyridinyl)oxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(5-methoxy-3-pyridinyl)oxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 140872433 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | tert-butyl (3S)-3-[(5-methoxy-3-pyridinyl)oxy]pyrrolidine-1-carboxylate |
| SMILES | COc1cncc(O[C@H]2CCN(C(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-15(2,3)21-14(18)17-6-5-11(10-17)20-13-7-12(19-4)8-16-9-13/h7-9,11H,5-6,10H2,1-4H3/t11-/m0/s1 |
| InChIKey | MZTVXTCXVYLKLN-NSHDSACASA-N |
| XLogP | 2.48 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |