C21H32BNO5 — CID 53413839
tert-butyl 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]piperidine-1-carboxylate (PubChem CID 53413839) has the molecular formula C21H32BNO5 and a molecular weight of 389.30 g/mol. Its IUPAC name is tert-butyl 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 53413839 |
| Molecular Formula | C21H32BNO5 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | tert-butyl 3-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]piperidine-1-carboxylate |
| SMILES | CC1(C)COB(c2ccc(OC3CCCN(C(=O)OC(C)(C)C)C3)cc2)OC1 |
| InChI | InChI=1S/C21H32BNO5/c1-20(2,3)28-19(24)23-12-6-7-18(13-23)27-17-10-8-16(9-11-17)22-25-14-21(4,5)15-26-22/h8-11,18H,6-7,12-15H2,1-5H3 |
| InChIKey | SXWJHXRXXNAYCO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|