C22H34BNO5 — CID 53413840
tert-butyl 3-[[2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]methyl]piperidine-1-carboxylate (PubChem CID 53413840) has the molecular formula C22H34BNO5 and a molecular weight of 403.33 g/mol. Its IUPAC name is tert-butyl 3-[[2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 53413840 |
| Molecular Formula | C22H34BNO5 |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | tert-butyl 3-[[2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenoxy]methyl]piperidine-1-carboxylate |
| SMILES | CC1(C)COB(c2ccccc2OCC2CCCN(C(=O)OC(C)(C)C)C2)OC1 |
| InChI | InChI=1S/C22H34BNO5/c1-21(2,3)29-20(25)24-12-8-9-17(13-24)14-26-19-11-7-6-10-18(19)23-27-15-22(4,5)16-28-23/h6-7,10-11,17H,8-9,12-16H2,1-5H3 |
| InChIKey | VYQZELKMMYPMDK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|