C21H30BNO5 — CID 67325765
tert-butyl 8-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3,4,4a,9a-tetrahydro-1H-[1]benzofuro[2,3-c]pyridine-2-carboxylate (PubChem CID 67325765) has the molecular formula C21H30BNO5 and a molecular weight of 387.29 g/mol. Its IUPAC name is tert-butyl 8-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3,4,4a,9a-tetrahydro-1H-[1]benzofuro[2,3-c]pyridine-2-carboxylate.
| Compound Name | tert-butyl 8-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3,4,4a,9a-tetrahydro-1H-[1]benzofuro[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 67325765 |
| Molecular Formula | C21H30BNO5 |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl 8-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-3,4,4a,9a-tetrahydro-1H-[1]benzofuro[2,3-c]pyridine-2-carboxylate |
| SMILES | CC1(C)COB(c2cccc3c2OC2CN(C(=O)OC(C)(C)C)CCC32)OC1 |
| InChI | InChI=1S/C21H30BNO5/c1-20(2,3)28-19(24)23-10-9-14-15-7-6-8-16(18(15)27-17(14)11-23)22-25-12-21(4,5)13-26-22/h6-8,14,17H,9-13H2,1-5H3 |
| InChIKey | CNXNGMPDTJYSDZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|