C14H21NO4 — CID 59674744
tert-butyl 4-(furan-3-yl)-3-hydroxypiperidine-1-carboxylate (PubChem CID 59674744) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is tert-butyl 4-(furan-3-yl)-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(furan-3-yl)-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 59674744 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | tert-butyl 4-(furan-3-yl)-3-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccoc2)C(O)C1 |
| InChI | InChI=1S/C14H21NO4/c1-14(2,3)19-13(17)15-6-4-11(12(16)8-15)10-5-7-18-9-10/h5,7,9,11-12,16H,4,6,8H2,1-3H3 |
| InChIKey | NILOZKOTYUTAGM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |