C21H27NO4 — CID 69225070
tert-butyl 4-(furan-3-yl)-3-phenylmethoxypiperidine-1-carboxylate (PubChem CID 69225070) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is tert-butyl 4-(furan-3-yl)-3-phenylmethoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(furan-3-yl)-3-phenylmethoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 69225070 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | tert-butyl 4-(furan-3-yl)-3-phenylmethoxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccoc2)C(OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H27NO4/c1-21(2,3)26-20(23)22-11-9-18(17-10-12-24-15-17)19(13-22)25-14-16-7-5-4-6-8-16/h4-8,10,12,15,18-19H,9,11,13-14H2,1-3H3 |
| InChIKey | NKDPGDWLLYZMID-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |