C22H35NO4 — CID 72640511
tert-butyl 3-(2-cyclohexylethoxy)-4-(furan-3-yl)piperidine-1-carboxylate (PubChem CID 72640511) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is tert-butyl 3-(2-cyclohexylethoxy)-4-(furan-3-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-cyclohexylethoxy)-4-(furan-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 72640511 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | tert-butyl 3-(2-cyclohexylethoxy)-4-(furan-3-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccoc2)C(OCCC2CCCCC2)C1 |
| InChI | InChI=1S/C22H35NO4/c1-22(2,3)27-21(24)23-12-9-19(18-11-13-25-16-18)20(15-23)26-14-10-17-7-5-4-6-8-17/h11,13,16-17,19-20H,4-10,12,14-15H2,1-3H3 |
| InChIKey | XCSAMXUMDBTFFX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |