C16H25N3O3 — CID 97172143
tert-butyl (3S)-3-(2-pyrimidin-2-yloxyethyl)piperidine-1-carboxylate (PubChem CID 97172143) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl (3S)-3-(2-pyrimidin-2-yloxyethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(2-pyrimidin-2-yloxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97172143 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | tert-butyl (3S)-3-(2-pyrimidin-2-yloxyethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](CCOc2ncccn2)C1 |
| InChI | InChI=1S/C16H25N3O3/c1-16(2,3)22-15(20)19-10-4-6-13(12-19)7-11-21-14-17-8-5-9-18-14/h5,8-9,13H,4,6-7,10-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | DJXBIQCBDXPJCV-ZDUSSCGKSA-N |
| XLogP | 2.89 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |