C18H28N2O3 — CID 71631003
tert-butyl 3-(3-pyridin-2-yloxypropyl)piperidine-1-carboxylate (PubChem CID 71631003) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl 3-(3-pyridin-2-yloxypropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-pyridin-2-yloxypropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71631003 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | tert-butyl 3-(3-pyridin-2-yloxypropyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CCCOc2ccccn2)C1 |
| InChI | InChI=1S/C18H28N2O3/c1-18(2,3)23-17(21)20-12-6-8-15(14-20)9-7-13-22-16-10-4-5-11-19-16/h4-5,10-11,15H,6-9,12-14H2,1-3H3 |
| InChIKey | DTWGPMWHHHRSBS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|