C19H30N2O3 — CID 71633708
tert-butyl 3-[2-(1-pyridin-2-ylethoxy)ethyl]piperidine-1-carboxylate (PubChem CID 71633708) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl 3-[2-(1-pyridin-2-ylethoxy)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(1-pyridin-2-ylethoxy)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71633708 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | tert-butyl 3-[2-(1-pyridin-2-ylethoxy)ethyl]piperidine-1-carboxylate |
| SMILES | CC(OCCC1CCCN(C(=O)OC(C)(C)C)C1)c1ccccn1 |
| InChI | InChI=1S/C19H30N2O3/c1-15(17-9-5-6-11-20-17)23-13-10-16-8-7-12-21(14-16)18(22)24-19(2,3)4/h5-6,9,11,15-16H,7-8,10,12-14H2,1-4H3 |
| InChIKey | ATCIWYGECNPJNW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |