C18H29N3O3 — CID 71633709
tert-butyl 3-[2-(1-pyrazin-2-ylethoxy)ethyl]piperidine-1-carboxylate (PubChem CID 71633709) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl 3-[2-(1-pyrazin-2-ylethoxy)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-(1-pyrazin-2-ylethoxy)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71633709 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | tert-butyl 3-[2-(1-pyrazin-2-ylethoxy)ethyl]piperidine-1-carboxylate |
| SMILES | CC(OCCC1CCCN(C(=O)OC(C)(C)C)C1)c1cnccn1 |
| InChI | InChI=1S/C18H29N3O3/c1-14(16-12-19-8-9-20-16)23-11-7-15-6-5-10-21(13-15)17(22)24-18(2,3)4/h8-9,12,14-15H,5-7,10-11,13H2,1-4H3 |
| InChIKey | LJTLFAVHFNGAOY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |