C20H28N2O3S — CID 71631021
tert-butyl 3-[3-(1,3-benzothiazol-2-yloxy)propyl]piperidine-1-carboxylate (PubChem CID 71631021) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is tert-butyl 3-[3-(1,3-benzothiazol-2-yloxy)propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(1,3-benzothiazol-2-yloxy)propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71631021 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | tert-butyl 3-[3-(1,3-benzothiazol-2-yloxy)propyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CCCOc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C20H28N2O3S/c1-20(2,3)25-19(23)22-12-6-8-15(14-22)9-7-13-24-18-21-16-10-4-5-11-17(16)26-18/h4-5,10-11,15H,6-9,12-14H2,1-3H3 |
| InChIKey | LMUCJSRIDSKHSW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|