C24H34N4O3 — CID 71631018
tert-butyl 3-[3-[3-(cyclopropylamino)quinoxalin-2-yl]oxypropyl]piperidine-1-carboxylate (PubChem CID 71631018) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is tert-butyl 3-[3-[3-(cyclopropylamino)quinoxalin-2-yl]oxypropyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[3-(cyclopropylamino)quinoxalin-2-yl]oxypropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71631018 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | tert-butyl 3-[3-[3-(cyclopropylamino)quinoxalin-2-yl]oxypropyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CCCOc2nc3ccccc3nc2NC2CC2)C1 |
| InChI | InChI=1S/C24H34N4O3/c1-24(2,3)31-23(29)28-14-6-8-17(16-28)9-7-15-30-22-21(25-18-12-13-18)26-19-10-4-5-11-20(19)27-22/h4-5,10-11,17-18H,6-9,12-16H2,1-3H3,(H,25,26) |
| InChIKey | VSMRZGJJHCLTRH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|