C21H30N4O3 — CID 97177754
tert-butyl (3S)-3-[[(3-ethoxyquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate (PubChem CID 97177754) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(3-ethoxyquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[(3-ethoxyquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97177754 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | tert-butyl (3S)-3-[[(3-ethoxyquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CCOc1nc2ccccc2nc1NC[C@@H]1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H30N4O3/c1-5-27-19-18(23-16-10-6-7-11-17(16)24-19)22-13-15-9-8-12-25(14-15)20(26)28-21(2,3)4/h6-7,10-11,15H,5,8-9,12-14H2,1-4H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | OLTWOUKTGVQVKL-HNNXBMFYSA-N |
| XLogP | 4.09 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |