C23H32N4O3 — CID 71631632
tert-butyl 2-[2-[3-(cyclopropylamino)quinoxalin-2-yl]oxyethyl]piperidine-1-carboxylate (PubChem CID 71631632) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is tert-butyl 2-[2-[3-(cyclopropylamino)quinoxalin-2-yl]oxyethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-[3-(cyclopropylamino)quinoxalin-2-yl]oxyethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71631632 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | tert-butyl 2-[2-[3-(cyclopropylamino)quinoxalin-2-yl]oxyethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CCOc1nc2ccccc2nc1NC1CC1 |
| InChI | InChI=1S/C23H32N4O3/c1-23(2,3)30-22(28)27-14-7-6-8-17(27)13-15-29-21-20(24-16-11-12-16)25-18-9-4-5-10-19(18)26-21/h4-5,9-10,16-17H,6-8,11-15H2,1-3H3,(H,24,25) |
| InChIKey | QMSXNPOPUHAGDN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |