C20H27N3O4 — CID 97168351
tert-butyl (2S)-2-[(3-methoxyquinoxalin-2-yl)oxymethyl]piperidine-1-carboxylate (PubChem CID 97168351) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3-methoxyquinoxalin-2-yl)oxymethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(3-methoxyquinoxalin-2-yl)oxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97168351 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | tert-butyl (2S)-2-[(3-methoxyquinoxalin-2-yl)oxymethyl]piperidine-1-carboxylate |
| SMILES | COc1nc2ccccc2nc1OC[C@@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27N3O4/c1-20(2,3)27-19(24)23-12-8-7-9-14(23)13-26-18-17(25-4)21-15-10-5-6-11-16(15)22-18/h5-6,10-11,14H,7-9,12-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | BSRQJZCUAYJICB-AWEZNQCLSA-N |
| XLogP | 3.81 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |