C18H23N3O3 — CID 71631412
tert-butyl 2-(quinoxalin-2-yloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 71631412) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is tert-butyl 2-(quinoxalin-2-yloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(quinoxalin-2-yloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71631412 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | tert-butyl 2-(quinoxalin-2-yloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1COc1cnc2ccccc2n1 |
| InChI | InChI=1S/C18H23N3O3/c1-18(2,3)24-17(22)21-10-6-7-13(21)12-23-16-11-19-14-8-4-5-9-15(14)20-16/h4-5,8-9,11,13H,6-7,10,12H2,1-3H3 |
| InChIKey | IWGRXFCCERTZHD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |