C18H23N3O4S — CID 97172970
tert-butyl (2R)-2-(quinoxalin-2-ylsulfonylmethyl)pyrrolidine-1-carboxylate (PubChem CID 97172970) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is tert-butyl (2R)-2-(quinoxalin-2-ylsulfonylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(quinoxalin-2-ylsulfonylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97172970 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | tert-butyl (2R)-2-(quinoxalin-2-ylsulfonylmethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CS(=O)(=O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C18H23N3O4S/c1-18(2,3)25-17(22)21-10-6-7-13(21)12-26(23,24)16-11-19-14-8-4-5-9-15(14)20-16/h4-5,8-9,11,13H,6-7,10,12H2,1-3H3/t13-/m1/s1 |
| InChIKey | JBLDJNZBJXABRN-CYBMUJFWSA-N |
| XLogP | 2.80 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |