C19H27N5O2 — CID 71647704
tert-butyl 2-[[(3-aminoquinoxalin-2-yl)-methylamino]methyl]pyrrolidine-1-carboxylate (PubChem CID 71647704) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is tert-butyl 2-[[(3-aminoquinoxalin-2-yl)-methylamino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(3-aminoquinoxalin-2-yl)-methylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71647704 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | tert-butyl 2-[[(3-aminoquinoxalin-2-yl)-methylamino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CN(CC1CCCN1C(=O)OC(C)(C)C)c1nc2ccccc2nc1N |
| InChI | InChI=1S/C19H27N5O2/c1-19(2,3)26-18(25)24-11-7-8-13(24)12-23(4)17-16(20)21-14-9-5-6-10-15(14)22-17/h5-6,9-10,13H,7-8,11-12H2,1-4H3,(H2,20,21) |
| InChIKey | ZTGWEQXFRCJNFF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |