C20H27N3O2 — CID 86593668
tert-butyl 2-[(quinolin-2-ylamino)methyl]piperidine-1-carboxylate (PubChem CID 86593668) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is tert-butyl 2-[(quinolin-2-ylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(quinolin-2-ylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86593668 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | tert-butyl 2-[(quinolin-2-ylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CNc1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H27N3O2/c1-20(2,3)25-19(24)23-13-7-6-9-16(23)14-21-18-12-11-15-8-4-5-10-17(15)22-18/h4-5,8,10-12,16H,6-7,9,13-14H2,1-3H3,(H,21,22) |
| InChIKey | KGROQTTZOZMKAK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |