C15H24N4O2 — CID 97176543
tert-butyl (2R)-2-[[(6-methylpyridazin-3-yl)amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 97176543) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(6-methylpyridazin-3-yl)amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[(6-methylpyridazin-3-yl)amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97176543 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | tert-butyl (2R)-2-[[(6-methylpyridazin-3-yl)amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(NC[C@H]2CCCN2C(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C15H24N4O2/c1-11-7-8-13(18-17-11)16-10-12-6-5-9-19(12)14(20)21-15(2,3)4/h7-8,12H,5-6,9-10H2,1-4H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | KRJDOEXJPXCVTK-GFCCVEGCSA-N |
| XLogP | 2.60 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |