C19H25ClN4O2 — CID 71631697
tert-butyl 2-[[(3-chloroquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate (PubChem CID 71631697) has the molecular formula C19H25ClN4O2 and a molecular weight of 376.89 g/mol. Its IUPAC name is tert-butyl 2-[[(3-chloroquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(3-chloroquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71631697 |
| Molecular Formula | C19H25ClN4O2 |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | tert-butyl 2-[[(3-chloroquinoxalin-2-yl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CNc1nc2ccccc2nc1Cl |
| InChI | InChI=1S/C19H25ClN4O2/c1-19(2,3)26-18(25)24-11-7-6-8-13(24)12-21-17-16(20)22-14-9-4-5-10-15(14)23-17/h4-5,9-10,13H,6-8,11-12H2,1-3H3,(H,21,23) |
| InChIKey | QTCFRLOVDRQIFE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |