C14H20ClN3O4S — CID 97172959
tert-butyl (2S)-2-[(6-chloropyridazin-3-yl)sulfonylmethyl]pyrrolidine-1-carboxylate (PubChem CID 97172959) has the molecular formula C14H20ClN3O4S and a molecular weight of 361.85 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(6-chloropyridazin-3-yl)sulfonylmethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(6-chloropyridazin-3-yl)sulfonylmethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 97172959 |
| Molecular Formula | C14H20ClN3O4S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | tert-butyl (2S)-2-[(6-chloropyridazin-3-yl)sulfonylmethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CS(=O)(=O)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C14H20ClN3O4S/c1-14(2,3)22-13(19)18-8-4-5-10(18)9-23(20,21)12-7-6-11(15)16-17-12/h6-7,10H,4-5,8-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | QROAIZDBZIKYEN-JTQLQIEISA-N |
| XLogP | 2.30 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |