C24H24ClF3N2O4S2 — CID 118624895
tert-butyl 2-[[4-[2-chloro-4-isothiocyanato-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]pyrrolidine-1-carboxylate (PubChem CID 118624895) has the molecular formula C24H24ClF3N2O4S2 and a molecular weight of 561.05 g/mol. Its IUPAC name is tert-butyl 2-[[4-[2-chloro-4-isothiocyanato-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-[2-chloro-4-isothiocyanato-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118624895 |
| Molecular Formula | C24H24ClF3N2O4S2 |
| Molecular Weight | 561.05 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | tert-butyl 2-[[4-[2-chloro-4-isothiocyanato-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CS(=O)(=O)c1ccc(-c2c(Cl)cc(N=C=S)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24ClF3N2O4S2/c1-23(2,3)34-22(31)30-10-4-5-17(30)13-36(32,33)18-8-6-15(7-9-18)21-19(24(26,27)28)11-16(29-14-35)12-20(21)25/h6-9,11-12,17H,4-5,10,13H2,1-3H3 |
| InChIKey | GFULFCGYUDLZKM-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.05 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|