C25H26ClF3N4O4S2 — CID 118632533
tert-butyl (2S)-1-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylate (PubChem CID 118632533) has the molecular formula C25H26ClF3N4O4S2 and a molecular weight of 603.09 g/mol. Its IUPAC name is tert-butyl (2S)-1-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 118632533 |
| Molecular Formula | C25H26ClF3N4O4S2 |
| Molecular Weight | 603.09 g/mol |
| Exact Mass | 602.10 |
| IUPAC Name | tert-butyl (2S)-1-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylate |
| SMILES | CS/C(=N\c1cc(Cl)c(-c2ccc(S(=O)(=O)N3CCC[C@H]3C(=O)OC(C)(C)C)cc2)c(C(F)(F)F)c1)NC#N |
| InChI | InChI=1S/C25H26ClF3N4O4S2/c1-24(2,3)37-22(34)20-6-5-11-33(20)39(35,36)17-9-7-15(8-10-17)21-18(25(27,28)29)12-16(13-19(21)26)32-23(38-4)31-14-30/h7-10,12-13,20H,5-6,11H2,1-4H3,(H,31,32)/t20-/m0/s1 |
| InChIKey | KRXBKESYGSXOBS-FQEVSTJZSA-N |
| XLogP | 5.94 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.09 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|