C18H16ClF3N2O4S — CID 141413793
(2S)-1-[4-[4-amino-2-chloro-6-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 141413793) has the molecular formula C18H16ClF3N2O4S and a molecular weight of 448.85 g/mol. Its IUPAC name is (2S)-1-[4-[4-amino-2-chloro-6-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[4-[4-amino-2-chloro-6-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 141413793 |
| Molecular Formula | C18H16ClF3N2O4S |
| Molecular Weight | 448.85 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | (2S)-1-[4-[4-amino-2-chloro-6-(trifluoromethyl)phenyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | Nc1cc(Cl)c(-c2ccc(S(=O)(=O)N3CCC[C@H]3C(=O)O)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16ClF3N2O4S/c19-14-9-11(23)8-13(18(20,21)22)16(14)10-3-5-12(6-4-10)29(27,28)24-7-1-2-15(24)17(25)26/h3-6,8-9,15H,1-2,7,23H2,(H,25,26)/t15-/m0/s1 |
| InChIKey | SHQPLFSZIYYWIL-HNNXBMFYSA-N |
| XLogP | 3.85 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|