C17H16ClF3N2O3S — CID 118625299
3-chloro-4-(4-morpholin-4-ylsulfonylphenyl)-5-(trifluoromethyl)aniline (PubChem CID 118625299) has the molecular formula C17H16ClF3N2O3S and a molecular weight of 420.84 g/mol. Its IUPAC name is 3-chloro-4-(4-morpholin-4-ylsulfonylphenyl)-5-(trifluoromethyl)aniline.
| Compound Name | 3-chloro-4-(4-morpholin-4-ylsulfonylphenyl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 118625299 |
| Molecular Formula | C17H16ClF3N2O3S |
| Molecular Weight | 420.84 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 3-chloro-4-(4-morpholin-4-ylsulfonylphenyl)-5-(trifluoromethyl)aniline |
| SMILES | Nc1cc(Cl)c(-c2ccc(S(=O)(=O)N3CCOCC3)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16ClF3N2O3S/c18-15-10-12(22)9-14(17(19,20)21)16(15)11-1-3-13(4-2-11)27(24,25)23-5-7-26-8-6-23/h1-4,9-10H,5-8,22H2 |
| InChIKey | KZIJBCLATZAFKI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.84 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|