C11H14ClFN2O3S — CID 62986370
3-chloro-4-fluoro-5-(1,4-oxazepan-4-ylsulfonyl)aniline (PubChem CID 62986370) has the molecular formula C11H14ClFN2O3S and a molecular weight of 308.76 g/mol. Its IUPAC name is 3-chloro-4-fluoro-5-(1,4-oxazepan-4-ylsulfonyl)aniline.
| Compound Name | 3-chloro-4-fluoro-5-(1,4-oxazepan-4-ylsulfonyl)aniline |
|---|---|
| PubChem CID | 62986370 |
| Molecular Formula | C11H14ClFN2O3S |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3-chloro-4-fluoro-5-(1,4-oxazepan-4-ylsulfonyl)aniline |
| SMILES | Nc1cc(Cl)c(F)c(S(=O)(=O)N2CCCOCC2)c1 |
| InChI | InChI=1S/C11H14ClFN2O3S/c12-9-6-8(14)7-10(11(9)13)19(16,17)15-2-1-4-18-5-3-15/h6-7H,1-5,14H2 |
| InChIKey | FOFRKCPKSKBLHN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|