C12H16N2O5S — CID 102931217
4-amino-2-(1,4-oxazepan-4-ylsulfonyl)benzoic acid (PubChem CID 102931217) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 4-amino-2-(1,4-oxazepan-4-ylsulfonyl)benzoic acid.
| Compound Name | 4-amino-2-(1,4-oxazepan-4-ylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 102931217 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-amino-2-(1,4-oxazepan-4-ylsulfonyl)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(S(=O)(=O)N2CCCOCC2)c1 |
| InChI | InChI=1S/C12H16N2O5S/c13-9-2-3-10(12(15)16)11(8-9)20(17,18)14-4-1-6-19-7-5-14/h2-3,8H,1,4-7,13H2,(H,15,16) |
| InChIKey | HYGFMWNPVNNTNV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|