C10H12N2O5S — CID 113402818
5-amino-2-(1,2-oxazolidin-2-ylsulfonyl)benzoic acid (PubChem CID 113402818) has the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. Its IUPAC name is 5-amino-2-(1,2-oxazolidin-2-ylsulfonyl)benzoic acid.
| Compound Name | 5-amino-2-(1,2-oxazolidin-2-ylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 113402818 |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 5-amino-2-(1,2-oxazolidin-2-ylsulfonyl)benzoic acid |
| SMILES | Nc1ccc(S(=O)(=O)N2CCCO2)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H12N2O5S/c11-7-2-3-9(8(6-7)10(13)14)18(15,16)12-4-1-5-17-12/h2-3,6H,1,4-5,11H2,(H,13,14) |
| InChIKey | FPNXTEWVQGLISA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|