C12H16N2O5S — CID 106773819
4-amino-2-[(3R)-3-methylmorpholin-4-yl]sulfonylbenzoic acid (PubChem CID 106773819) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is 4-amino-2-[(3R)-3-methylmorpholin-4-yl]sulfonylbenzoic acid.
| Compound Name | 4-amino-2-[(3R)-3-methylmorpholin-4-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 106773819 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-amino-2-[(3R)-3-methylmorpholin-4-yl]sulfonylbenzoic acid |
| SMILES | C[C@@H]1COCCN1S(=O)(=O)c1cc(N)ccc1C(=O)O |
| InChI | InChI=1S/C12H16N2O5S/c1-8-7-19-5-4-14(8)20(17,18)11-6-9(13)2-3-10(11)12(15)16/h2-3,6,8H,4-5,7,13H2,1H3,(H,15,16)/t8-/m1/s1 |
| InChIKey | POTXLFXASGDVCS-MRVPVSSYSA-N |
| XLogP | 0.38 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|