C14H20N2O4S — CID 102931184
4-amino-2-(2,3-dimethylpiperidin-1-yl)sulfonylbenzoic acid (PubChem CID 102931184) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-amino-2-(2,3-dimethylpiperidin-1-yl)sulfonylbenzoic acid.
| Compound Name | 4-amino-2-(2,3-dimethylpiperidin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 102931184 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 4-amino-2-(2,3-dimethylpiperidin-1-yl)sulfonylbenzoic acid |
| SMILES | CC1CCCN(S(=O)(=O)c2cc(N)ccc2C(=O)O)C1C |
| InChI | InChI=1S/C14H20N2O4S/c1-9-4-3-7-16(10(9)2)21(19,20)13-8-11(15)5-6-12(13)14(17)18/h5-6,8-10H,3-4,7,15H2,1-2H3,(H,17,18) |
| InChIKey | KMTAMFLYTLLPRB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|