C13H18N2O4S — CID 122104966
(2R,3R)-1-(2-aminophenyl)sulfonyl-2-methylpiperidine-3-carboxylic acid (PubChem CID 122104966) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is (2R,3R)-1-(2-aminophenyl)sulfonyl-2-methylpiperidine-3-carboxylic acid.
| Compound Name | (2R,3R)-1-(2-aminophenyl)sulfonyl-2-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122104966 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (2R,3R)-1-(2-aminophenyl)sulfonyl-2-methylpiperidine-3-carboxylic acid |
| SMILES | C[C@@H]1[C@H](C(=O)O)CCCN1S(=O)(=O)c1ccccc1N |
| InChI | InChI=1S/C13H18N2O4S/c1-9-10(13(16)17)5-4-8-15(9)20(18,19)12-7-3-2-6-11(12)14/h2-3,6-7,9-10H,4-5,8,14H2,1H3,(H,16,17)/t9-,10-/m1/s1 |
| InChIKey | LKVUWYWJTHDSOZ-NXEZZACHSA-N |
| XLogP | 1.14 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|