C15H19NO4S — CID 122104769
(2R,3R)-1-(4-ethenylphenyl)sulfonyl-2-methylpiperidine-3-carboxylic acid (PubChem CID 122104769) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (2R,3R)-1-(4-ethenylphenyl)sulfonyl-2-methylpiperidine-3-carboxylic acid.
| Compound Name | (2R,3R)-1-(4-ethenylphenyl)sulfonyl-2-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122104769 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2R,3R)-1-(4-ethenylphenyl)sulfonyl-2-methylpiperidine-3-carboxylic acid |
| SMILES | C=Cc1ccc(S(=O)(=O)N2CCC[C@@H](C(=O)O)[C@H]2C)cc1 |
| InChI | InChI=1S/C15H19NO4S/c1-3-12-6-8-13(9-7-12)21(19,20)16-10-4-5-14(11(16)2)15(17)18/h3,6-9,11,14H,1,4-5,10H2,2H3,(H,17,18)/t11-,14-/m1/s1 |
| InChIKey | WXTYKNJRXVDGES-BXUZGUMPSA-N |
| XLogP | 2.20 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |