C11H15BrN2O2S — CID 65206811
4-bromo-3-(2-methylpyrrolidin-1-yl)sulfonylaniline (PubChem CID 65206811) has the molecular formula C11H15BrN2O2S and a molecular weight of 319.22 g/mol. Its IUPAC name is 4-bromo-3-(2-methylpyrrolidin-1-yl)sulfonylaniline.
| Compound Name | 4-bromo-3-(2-methylpyrrolidin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 65206811 |
| Molecular Formula | C11H15BrN2O2S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 4-bromo-3-(2-methylpyrrolidin-1-yl)sulfonylaniline |
| SMILES | CC1CCCN1S(=O)(=O)c1cc(N)ccc1Br |
| InChI | InChI=1S/C11H15BrN2O2S/c1-8-3-2-6-14(8)17(15,16)11-7-9(13)4-5-10(11)12/h4-5,7-8H,2-3,6,13H2,1H3 |
| InChIKey | DOHKHQZNBARMJE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|