C12H17BrN2O4S — CID 81205329
[4-(5-amino-2-bromophenyl)sulfonyl-5-methylmorpholin-2-yl]methanol (PubChem CID 81205329) has the molecular formula C12H17BrN2O4S and a molecular weight of 365.25 g/mol. Its IUPAC name is [4-(5-amino-2-bromophenyl)sulfonyl-5-methylmorpholin-2-yl]methanol.
| Compound Name | [4-(5-amino-2-bromophenyl)sulfonyl-5-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 81205329 |
| Molecular Formula | C12H17BrN2O4S |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | [4-(5-amino-2-bromophenyl)sulfonyl-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1S(=O)(=O)c1cc(N)ccc1Br |
| InChI | InChI=1S/C12H17BrN2O4S/c1-8-7-19-10(6-16)5-15(8)20(17,18)12-4-9(14)2-3-11(12)13/h2-4,8,10,16H,5-7,14H2,1H3 |
| InChIKey | VHGDAFXWJCTFEC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|