C14H18INO4S — CID 103962466
5-(2,3-dimethylpiperidin-1-yl)sulfonyl-2-iodobenzoic acid (PubChem CID 103962466) has the molecular formula C14H18INO4S and a molecular weight of 423.27 g/mol. Its IUPAC name is 5-(2,3-dimethylpiperidin-1-yl)sulfonyl-2-iodobenzoic acid.
| Compound Name | 5-(2,3-dimethylpiperidin-1-yl)sulfonyl-2-iodobenzoic acid |
|---|---|
| PubChem CID | 103962466 |
| Molecular Formula | C14H18INO4S |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 423.00 |
| IUPAC Name | 5-(2,3-dimethylpiperidin-1-yl)sulfonyl-2-iodobenzoic acid |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(I)c(C(=O)O)c2)C1C |
| InChI | InChI=1S/C14H18INO4S/c1-9-4-3-7-16(10(9)2)21(19,20)11-5-6-13(15)12(8-11)14(17)18/h5-6,8-10H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | GESGYLHRCLWUOH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|