C9H13N3O5S — CID 93350476
5-[(3R)-3-methylmorpholin-4-yl]sulfonyl-1H-pyrazole-4-carboxylic acid (PubChem CID 93350476) has the molecular formula C9H13N3O5S and a molecular weight of 275.29 g/mol. Its IUPAC name is 5-[(3R)-3-methylmorpholin-4-yl]sulfonyl-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-[(3R)-3-methylmorpholin-4-yl]sulfonyl-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 93350476 |
| Molecular Formula | C9H13N3O5S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 5-[(3R)-3-methylmorpholin-4-yl]sulfonyl-1H-pyrazole-4-carboxylic acid |
| SMILES | C[C@@H]1COCCN1S(=O)(=O)c1[nH]ncc1C(=O)O |
| InChI | InChI=1S/C9H13N3O5S/c1-6-5-17-3-2-12(6)18(15,16)8-7(9(13)14)4-10-11-8/h4,6H,2-3,5H2,1H3,(H,10,11)(H,13,14)/t6-/m1/s1 |
| InChIKey | GWEBNXBTZPDMKO-ZCFIWIBFSA-N |
| XLogP | -0.48 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |