C10H15N3O5S — CID 62034394
5-methyl-3-(3-methylmorpholin-4-yl)sulfonyl-1H-pyrazole-4-carboxylic acid (PubChem CID 62034394) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is 5-methyl-3-(3-methylmorpholin-4-yl)sulfonyl-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-methyl-3-(3-methylmorpholin-4-yl)sulfonyl-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 62034394 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-methyl-3-(3-methylmorpholin-4-yl)sulfonyl-1H-pyrazole-4-carboxylic acid |
| SMILES | Cc1[nH]nc(S(=O)(=O)N2CCOCC2C)c1C(=O)O |
| InChI | InChI=1S/C10H15N3O5S/c1-6-5-18-4-3-13(6)19(16,17)9-8(10(14)15)7(2)11-12-9/h6H,3-5H2,1-2H3,(H,11,12)(H,14,15) |
| InChIKey | DPXAWCKUGUJPHC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |