C11H17N3O4S — CID 62032946
5-methyl-3-(2-methylpiperidin-1-yl)sulfonyl-1H-pyrazole-4-carboxylic acid (PubChem CID 62032946) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-methyl-3-(2-methylpiperidin-1-yl)sulfonyl-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-methyl-3-(2-methylpiperidin-1-yl)sulfonyl-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 62032946 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 5-methyl-3-(2-methylpiperidin-1-yl)sulfonyl-1H-pyrazole-4-carboxylic acid |
| SMILES | Cc1[nH]nc(S(=O)(=O)N2CCCCC2C)c1C(=O)O |
| InChI | InChI=1S/C11H17N3O4S/c1-7-5-3-4-6-14(7)19(17,18)10-9(11(15)16)8(2)12-13-10/h7H,3-6H2,1-2H3,(H,12,13)(H,15,16) |
| InChIKey | PWOMDYVTVBMDQL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |