C11H18N4O3S — CID 65373616
5-methyl-3-(2-methylpiperidine-1-carbonyl)-1H-pyrazole-4-sulfonamide (PubChem CID 65373616) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 5-methyl-3-(2-methylpiperidine-1-carbonyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-methyl-3-(2-methylpiperidine-1-carbonyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 65373616 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-methyl-3-(2-methylpiperidine-1-carbonyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1[nH]nc(C(=O)N2CCCCC2C)c1S(N)(=O)=O |
| InChI | InChI=1S/C11H18N4O3S/c1-7-5-3-4-6-15(7)11(16)9-10(19(12,17)18)8(2)13-14-9/h7H,3-6H2,1-2H3,(H,13,14)(H2,12,17,18) |
| InChIKey | ZMCODKLCSYGUDH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |