C13H22N4O3S — CID 65386781
5-ethyl-3-(2-ethylpiperidine-1-carbonyl)-1H-pyrazole-4-sulfonamide (PubChem CID 65386781) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 5-ethyl-3-(2-ethylpiperidine-1-carbonyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 5-ethyl-3-(2-ethylpiperidine-1-carbonyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 65386781 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 5-ethyl-3-(2-ethylpiperidine-1-carbonyl)-1H-pyrazole-4-sulfonamide |
| SMILES | CCc1[nH]nc(C(=O)N2CCCCC2CC)c1S(N)(=O)=O |
| InChI | InChI=1S/C13H22N4O3S/c1-3-9-7-5-6-8-17(9)13(18)11-12(21(14,19)20)10(4-2)15-16-11/h9H,3-8H2,1-2H3,(H,15,16)(H2,14,19,20) |
| InChIKey | ZZRFDMSUALVENF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |