C7H11N3O4S — CID 62033307
3-(dimethylsulfamoyl)-5-methyl-1H-pyrazole-4-carboxylic acid (PubChem CID 62033307) has the molecular formula C7H11N3O4S and a molecular weight of 233.25 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-5-methyl-1H-pyrazole-4-carboxylic acid.
| Compound Name | 3-(dimethylsulfamoyl)-5-methyl-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 62033307 |
| Molecular Formula | C7H11N3O4S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 3-(dimethylsulfamoyl)-5-methyl-1H-pyrazole-4-carboxylic acid |
| SMILES | Cc1[nH]nc(S(=O)(=O)N(C)C)c1C(=O)O |
| InChI | InChI=1S/C7H11N3O4S/c1-4-5(7(11)12)6(9-8-4)15(13,14)10(2)3/h1-3H3,(H,8,9)(H,11,12) |
| InChIKey | SSQUAZYLSQDEGS-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |