C11H16N2O5S — CID 93044965
1-methyl-4-[(3R)-3-methylmorpholin-4-yl]sulfonylpyrrole-2-carboxylic acid (PubChem CID 93044965) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is 1-methyl-4-[(3R)-3-methylmorpholin-4-yl]sulfonylpyrrole-2-carboxylic acid.
| Compound Name | 1-methyl-4-[(3R)-3-methylmorpholin-4-yl]sulfonylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 93044965 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 1-methyl-4-[(3R)-3-methylmorpholin-4-yl]sulfonylpyrrole-2-carboxylic acid |
| SMILES | C[C@@H]1COCCN1S(=O)(=O)c1cc(C(=O)O)n(C)c1 |
| InChI | InChI=1S/C11H16N2O5S/c1-8-7-18-4-3-13(8)19(16,17)9-5-10(11(14)15)12(2)6-9/h5-6,8H,3-4,7H2,1-2H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | BDYUVBVDRKWDKB-MRVPVSSYSA-N |
| XLogP | 0.13 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |