C7H9NO4S — CID 130741951
1-methyl-4-methylsulfonylpyrrole-2-carboxylic acid (PubChem CID 130741951) has the molecular formula C7H9NO4S and a molecular weight of 203.22 g/mol. Its IUPAC name is 1-methyl-4-methylsulfonylpyrrole-2-carboxylic acid.
| Compound Name | 1-methyl-4-methylsulfonylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 130741951 |
| Molecular Formula | C7H9NO4S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 1-methyl-4-methylsulfonylpyrrole-2-carboxylic acid |
| SMILES | Cn1cc(S(C)(=O)=O)cc1C(=O)O |
| InChI | InChI=1S/C7H9NO4S/c1-8-4-5(13(2,11)12)3-6(8)7(9)10/h3-4H,1-2H3,(H,9,10) |
| InChIKey | MIZPDNOBWPLZJK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |